Compound Q&A

What are the physical and chemical properties of hexyl(diphenyl)phosphine (CAS: 18298-00-5)?

Answer

Hexyl(diphenyl)phosphine
Hexyl(diphenyl)phosphine is a colorless to light yellow liquid with a molecular weight of approximately 278.27 g/mol. It is slightly soluble in water but highly soluble in organic solvents. Chemically, it is a phosphine, which makes it potentially reactive, particularly in the presence of oxidizing agents. It is used as a reducing agent and as a ligand in organophosphorus chemistry.

About

CAS No 18298-00-5
English Name Hexyl(diphenyl)phosphine
Molecular Formula C18H23P
Molecular Weight 270.35600000000005 g/mol
SMILES CCCCCCP(C1=CC=CC=C1)C2=CC=CC=C2
InChIKey WHNGQRQJGDUZPJ-UHFFFAOYSA-N
Last Updated: 2026-03-08 00:27

Related Q&A

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnesium bromide with pho...

Compound Q&A

What industries use hexyl(diphenyl)phosphine (CAS: 18298-00-5)?

Hexyl(diphenyl)phosphine is used in various industries, including pharmaceuticals for the synthesis ...

Compound Q&A

What precautions should be taken when handling hexyl(diphenyl)phosphine (CAS: 18298-00-5)?

When handling hexyl(diphenyl)phosphine, it is essential to use appropriate personal protective equip...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene