Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Answer

Tetraphenylthiophene
Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key intermediate in the production of organic semiconductors, particularly in organic photovoltaics and organic electronics. It also plays a role in the development of certain pharmaceuticals and is utilized in the synthesis of polymers with specific electronic properties. Additionally, it has applications in gas sensors for detecting hydrogen and other gases.

About

CAS No 1884-68-0
English Name Tetraphenylthiophene
Molecular Formula C28H20S
Molecular Weight 388.535 g/mol
SMILES C1=CC=C(C=C1)C2=C(SC(=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5
InChIKey MQFBWJOMLIHUDY-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is Tetraphenylthiophene (CAS: 1884-68-0) typically synthesized?

Tetraphenylthiophene (CAS: 1884-68-0) is commonly synthesized via the Friedel-Crafts alkylation of t...

Compound Q&A

What precautions should be taken when handling Tetraphenylthiophene (CAS: 1884-68-0)?

When handling Tetraphenylthiophene (CAS: 1884-68-0), appropriate personal protective equipment (PPE)...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene