Compound Q&A

What are the physical and chemical properties of (2R,3S)-2-{(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholine (CAS: 170729-79-0)?

Answer

(2R,3S)-2-{(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholine
This compound is a crystalline solid with a high molecular weight. It has low water solubility but good solubility in organic solvents like dichloromethane and acetonitrile. Chemically, it shows moderate reactivity with hydrides and nucleophiles. The compound is stable under normal conditions but should be stored away from moisture and heat.

About

English Name (2R,3S)-2-{(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholine
Molecular Formula C20H18F7NO2
Molecular Weight 437.36 g/mol
SMILES CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)OC2C(NCCO2)C3=CC=C(C=C3)F
InChIKey AFBDSAJOMZYQAI-CNOZUTPLSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

How is (2R,3S)-2-{(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholine (CAS: 170729-79-0) typically synthesized?

The compound is synthesized via a multi-step process involving alkylation and coupling reactions. Ke...

Compound Q&A

What industries use (2R,3S)-2-{(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholine (CAS: 170729-79-0)?

This compound is used in pharmaceuticals for its potential in drug development due to its unique str...

Compound Q&A

What precautions should be taken when handling (2R,3S)-2-{(1R)-1-[3,5-Bis(trifluoromethyl)phenyl]ethoxy}-3-(4-fluorophenyl)morpholine (CAS: 170729-79-0)?

When handling this compound, use personal protective equipment (PPE) such as gloves, goggles, and a ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...