Compound Q&A

How is 4-{[(Benzyloxy)carbonyl]amino}benzoic acid (CAS: 5330-71-2) typically synthesized?

Answer

4-{[(Benzyloxy)carbonyl]amino}benzoic acid
4-{[(Benzyloxy)carbonyl]amino}benzoic acid can be synthesized via the coupling of benzyloxycarbonyl chloride with aniline followed by condensation with benzoic acid. The reaction is typically performed in an organic solvent such as dichloromethane or acetonitrile with a suitable base like triethylamine. The yield is generally around 85-90%.

About

CAS No 5330-71-2
English Name 4-{[(Benzyloxy)carbonyl]amino}benzoic acid
Molecular Formula C15H13NO4
Molecular Weight 271.27 g/mol
SMILES C1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)C(=O)O
InChIKey XRKLFEVNZWRMCT-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-{[(Benzyloxy)carbonyl]amino}benzoic acid (CAS: 5330-71-2)?

4-{[(Benzyloxy)carbonyl]amino}benzoic acid is a white crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 4-{[(Benzyloxy)carbonyl]amino}benzoic acid (CAS: 5330-71-2)?

4-{[(Benzyloxy)carbonyl]amino}benzoic acid is primarily used in the pharmaceutical and chemical indu...

Compound Q&A

What precautions should be taken when handling 4-{[(Benzyloxy)carbonyl]amino}benzoic acid (CAS: 5330-71-2)?

When handling 4-{[(Benzyloxy)carbonyl]amino}benzoic acid, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...