Compound Q&A

What industries use Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8)?

Answer

Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate
Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) is primarily used in the pharmaceutical and chemical industries for the synthesis of intermediates and APIs. It also finds applications in the polymer industry for the development of novel materials with specific properties. Additionally, this compound can be utilized in the fragrance and flavor industry as a precursor for fragrances and flavorings.

About

English Name Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate
Molecular Formula C18H20O3
Molecular Weight 284.35 g/mol
SMILES CC1=CC(=C(C=C1)OC)C(CC(=O)OC)C2=CC=CC=C2
InChIKey BJQJPTJDNINOMT-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8)?

Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) is a colorless or slightly...

Compound Q&A

How is Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) typically synthesized?

Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) can be synthesized via a m...

Compound Q&A

What precautions should be taken when handling Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8)?

When handling Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8), it is cruci...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...