Compound Q&A

How is Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) typically synthesized?

Answer

Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate
Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) can be synthesized via a multistep process involving esterification and subsequent coupling reactions. Typically, 2-methoxy-5-methylbenzaldehyde reacts with phenylmagnesium bromide to form the corresponding ketone, which is then coupled with methyl propionate. This process requires careful control of reaction conditions and the use of appropriate catalysts and solvents to achieve high selectivity and yield.

About

English Name Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate
Molecular Formula C18H20O3
Molecular Weight 284.35 g/mol
SMILES CC1=CC(=C(C=C1)OC)C(CC(=O)OC)C2=CC=CC=C2
InChIKey BJQJPTJDNINOMT-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8)?

Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) is a colorless or slightly...

Compound Q&A

What industries use Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8)?

Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8) is primarily used in the p...

Compound Q&A

What precautions should be taken when handling Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8)?

When handling Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropanoate (CAS: 124937-62-8), it is cruci...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...