Compound Q&A

How is 3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS: 93041-44-2) typically synthesized?

Answer

3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid can be synthesized via a multistep approach, starting with 2-methoxybenzaldehyde and methyl acetoacetate. The key steps involve condensation, protection, deprotection, and final acylation. This synthesis typically uses mild reagents and conditions to ensure high yield and selectivity. Commonly, catalysts like p-toluidine or p-toluenesulfonic acid are used.

About

CAS No 93041-44-2
English Name 3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
Molecular Formula C12H11NO4
Molecular Weight 233.22 g/mol
SMILES CC1=C(C(=NO1)C2=CC=CC=C2OC)C(=O)O
InChIKey KOQSJBSGCNLIJY-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS: 93041-44-2)?

3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid is a white to off-white crystalline solid...

Compound Q&A

What industries use 3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS: 93041-44-2)?

3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid finds applications in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS: 93041-44-2)?

When handling 3-(2-Methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxylic acid, ensure the use of appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...