Compound Q&A

How is Desmethyl Doxylamine (CAS: 1221-70-1) typically synthesized?

Answer

Desmethyl Doxylamine
Desmethyl Doxylamine can be synthesized through a reduction process of doxylamine, where sodium borohydride or lithium aluminum hydride is used as a reducing agent. The synthesis involves careful control of temperature and reaction time to achieve high yield. Detailed procedures can be found in organic chemistry literature and patents.

About

CAS No 1221-70-1
English Name Desmethyl Doxylamine
Molecular Formula C16H20N2O
Molecular Weight 256.35 g/mol
SMILES CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=N2
InChIKey OKKTWMJPOLLMMV-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Desmethyl Doxylamine (CAS: 1221-70-1)?

Desmethyl Doxylamine is a white crystalline solid with a molecular weight of approximately 276.34 g/...

Compound Q&A

What industries use Desmethyl Doxylamine (CAS: 1221-70-1)?

Desmethyl Doxylamine is primarily used in the pharmaceutical industry as an intermediate in the synt...

Compound Q&A

What precautions should be taken when handling Desmethyl Doxylamine (CAS: 1221-70-1)?

When handling Desmethyl Doxylamine, it is essential to wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...