Compound Q&A

What are the physical and chemical properties of Desmethyl Doxylamine (CAS: 1221-70-1)?

Answer

Desmethyl Doxylamine
Desmethyl Doxylamine is a white crystalline solid with a molecular weight of approximately 276.34 g/mol. It is slightly soluble in water and ethanol. The compound is relatively stable under normal conditions but can react with strong acids or bases. It has a melting point of about 140-142°C. For detailed properties, refer to the Material Safety Data Sheet (MSDS).

About

CAS No 1221-70-1
English Name Desmethyl Doxylamine
Molecular Formula C16H20N2O
Molecular Weight 256.35 g/mol
SMILES CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=N2
InChIKey OKKTWMJPOLLMMV-UHFFFAOYSA-N
Last Updated: 2026-03-07 19:49

Related Q&A

Compound Q&A

How is Desmethyl Doxylamine (CAS: 1221-70-1) typically synthesized?

Desmethyl Doxylamine can be synthesized through a reduction process of doxylamine, where sodium boro...

Compound Q&A

What industries use Desmethyl Doxylamine (CAS: 1221-70-1)?

Desmethyl Doxylamine is primarily used in the pharmaceutical industry as an intermediate in the synt...

Compound Q&A

What precautions should be taken when handling Desmethyl Doxylamine (CAS: 1221-70-1)?

When handling Desmethyl Doxylamine, it is essential to wear appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...