Compound Q&A

What industries use 2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5)?

Answer

2-(4-Nitrophenyl)propanenitrile
2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in the production of polymers, where its functional groups can be used for crosslinking or grafting. Additionally, it can be employed in the development of sensors and semiconductors due to its specific chemical properties.

About

CAS No 50712-63-5
English Name 2-(4-Nitrophenyl)propanenitrile
Molecular Formula C9H8N2O2
Molecular Weight 176.17 g/mol
SMILES CC(C#N)C1=CC=C(C=C1)[N+](=O)[O-]
InChIKey QCPKTMACPAKCKW-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5)?

2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5) is a colorless to white crystalline solid with a m...

Compound Q&A

How is 2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5) typically synthesized?

2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5) is commonly synthesized through the reaction of 2-...

Compound Q&A

What precautions should be taken when handling 2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5)?

When handling 2-(4-Nitrophenyl)propanenitrile (CAS: 50712-63-5), it is important to use appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...