Compound Q&A

How is 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3) typically synthesized?

Answer

5-Amino-2,4-dihydroxybenzoic acid
5-Amino-2,4-dihydroxybenzoic acid is usually synthesized from 2,4-dihydroxybenzoic acid through an amino group introduction step. Common methods include nucleophilic substitution or direct amide formation using reagents like sodium amide, followed by quenching and purification.

About

CAS No 69938-56-3
English Name 5-Amino-2,4-dihydroxybenzoic acid
Molecular Formula C7H7NO4
Molecular Weight 169.14 g/mol
SMILES C1=C(C(=CC(=C1N)O)O)C(=O)O
InChIKey WCDMNZRFRZYKDG-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3)?

5-Amino-2,4-dihydroxybenzoic acid is a white crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3)?

5-Amino-2,4-dihydroxybenzoic acid finds applications in pharmaceuticals, where it serves as a precur...

Compound Q&A

What precautions should be taken when handling 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3)?

When handling 5-Amino-2,4-dihydroxybenzoic acid, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...