Compound Q&A

What are the physical and chemical properties of 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3)?

Answer

5-Amino-2,4-dihydroxybenzoic acid
5-Amino-2,4-dihydroxybenzoic acid is a white crystalline solid with a molecular weight of approximately 212.16 g/mol. It has a solubility of about 0.4 g/L in water. This compound is moderately reactive, particularly under acidic conditions. It shows typical phenolic and aromatic acid properties.

About

CAS No 69938-56-3
English Name 5-Amino-2,4-dihydroxybenzoic acid
Molecular Formula C7H7NO4
Molecular Weight 169.14 g/mol
SMILES C1=C(C(=CC(=C1N)O)O)C(=O)O
InChIKey WCDMNZRFRZYKDG-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3) typically synthesized?

5-Amino-2,4-dihydroxybenzoic acid is usually synthesized from 2,4-dihydroxybenzoic acid through an a...

Compound Q&A

What industries use 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3)?

5-Amino-2,4-dihydroxybenzoic acid finds applications in pharmaceuticals, where it serves as a precur...

Compound Q&A

What precautions should be taken when handling 5-Amino-2,4-dihydroxybenzoic acid (CAS: 69938-56-3)?

When handling 5-Amino-2,4-dihydroxybenzoic acid, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...