Compound Q&A

What precautions should be taken when handling a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0)?

Answer

a-Bromo-N-Boc-Gly-OtBu
When handling a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0), ensure the use of appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure to bromine vapor. Store the compound in a cool, dry place away from direct sunlight and flammable materials. In case of a spill, follow standard laboratory safety protocols and consult the safety data sheet (SDS) for specific instructions.

About

English Name a-Bromo-N-Boc-Gly-OtBu
Molecular Formula C11H20BrNO4
Molecular Weight 310.19 g/mol
SMILES CC(C)(C)OC(=O)C(NC(=O)OC(C)(C)C)Br
InChIKey RBGAAZPKHKBDGM-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0)?

a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0) typically synthesized?

a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0) is typically synthesized through a multistep process invol...

Compound Q&A

What industries use a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0)?

a-Bromo-N-Boc-Gly-OtBu (CAS: 117833-60-0) is primarily used in the pharmaceutical and biotechnology ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...