Compound Q&A

How should (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7) be stored?

Answer

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile
(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent evaporation and contamination. Ensure proper ventilation in the storage area to minimize the risk of inhalation exposure.

About

English Name (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile
Molecular Formula C10H9N3O
Molecular Weight 187.2 g/mol
SMILES COC1=CC=CC2=C1N=C(N2)CC#N
InChIKey PUVMVNRIJSTIGD-UHFFFAOYSA-N
Last Updated: 2026-03-07 11:14

Related Q&A

Compound Q&A

What is (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7)?

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile is a chemical compound with the CAS number 317817-41-7....

Compound Q&A

What are the main uses of (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7)?

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile is primarily used in the synthesis of pharmaceuticals, ...

Compound Q&A

Is (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7) safe?

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile is generally considered safe for laboratory use when pr...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A