Compound Q&A

What are the main uses of (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7)?

Answer

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile
(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile is primarily used in the synthesis of pharmaceuticals, particularly as an intermediate in the development of new drugs. It is also utilized in research and development for its unique chemical properties.

About

English Name (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile
Molecular Formula C10H9N3O
Molecular Weight 187.2 g/mol
SMILES COC1=CC=CC2=C1N=C(N2)CC#N
InChIKey PUVMVNRIJSTIGD-UHFFFAOYSA-N
Last Updated: 2026-03-07 11:14

Related Q&A

Compound Q&A

What is (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7)?

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile is a chemical compound with the CAS number 317817-41-7....

Compound Q&A

Is (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7) safe?

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile is generally considered safe for laboratory use when pr...

Compound Q&A

How should (4-Methoxy-1H-benzimidazol-2-yl)acetonitrile (CAS: 317817-41-7) be stored?

(4-Methoxy-1H-benzimidazol-2-yl)acetonitrile should be stored in a cool, dry place away from direct ...

Compound Q&A

How is Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) typically synthesized?

Ethyl 4-chlorothieno[2,3-b]pyridine-5-carboxylate (CAS: 59713-58-5) can be synth...

59713-58-5Ethyl 4-chlorothieno...
Compound Q&A

What regulatory guidelines apply to 5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2)?

5-Methyl-1H-indole-3-carbaldehyde (CAS: 52562-50-2) is subject to various regula...

52562-50-25-Methyl-1H-indole-3...
Compound Q&A

What are the physical and chemical properties of (1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid (CAS: 223418-73-3)?

(1,3-Dimethyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinyl)boronic acid is a white...

223418-73-3(1,3-Dimethyl-2,4-di...
Compound Q&A

How should waste containing Sulfocostunolide A (CAS: 1016983-51-9) be handled?

Waste containing Sulfocostunolide A (CAS: 1016983-51-9) should be handled with c...

1016983-51-9Sulfocostunolide A