Compound Q&A

How should (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) be stored?

Answer

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one
(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) should be stored in a cool, dry place, away from direct sunlight and heat sources to maintain its stability. It should be kept in a tightly sealed container to prevent contamination and degradation. Proper storage conditions are essential to ensure the safety and effectiveness of the compound.

About

CAS No 68760-11-2
English Name (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one
Molecular Formula C11H12N2O3
Molecular Weight 220.22 g/mol
SMILES CN(C)C=CC(=O)C1=CC=C(C=C1)[N+](=O)[O-]
InChIKey LIOPOMJNIUNMRH-BQYQJAHWSA-N
Last Updated: 2026-03-07 07:31

Related Q&A

Compound Q&A

What is (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2)?

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one is a chemical compound with the CAS number 6...

Compound Q&A

What are the main uses of (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2)?

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) is primarily used in pharm...

Compound Q&A

Is (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) safe?

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) is generally safe when han...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...