Compound Q&A

What are the main uses of (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2)?

Answer

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one
(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) is primarily used in pharmaceuticals for the synthesis of other compounds and in research for various chemical reactions. It also has applications in the dye and pigment industries.

About

CAS No 68760-11-2
English Name (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one
Molecular Formula C11H12N2O3
Molecular Weight 220.22 g/mol
SMILES CN(C)C=CC(=O)C1=CC=C(C=C1)[N+](=O)[O-]
InChIKey LIOPOMJNIUNMRH-BQYQJAHWSA-N
Last Updated: 2026-03-07 07:31

Related Q&A

Compound Q&A

What is (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2)?

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one is a chemical compound with the CAS number 6...

Compound Q&A

Is (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) safe?

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) is generally safe when han...

Compound Q&A

How should (2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) be stored?

(2E)-3-(Dimethylamino)-1-(4-nitrophenyl)-2-propen-1-one (CAS: 68760-11-2) should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...