Compound Q&A

What is the market or research trend for Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5)?

Answer

Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid
The market and research trends for Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5) are focused on its use in pharmaceutical and biotech industries, particularly in drug synthesis and development. Emerging research fields include its application in anticancer and antibacterial drugs. Market demand is increasing due to its unique chemical properties and efficacy in various medicinal applications.

About

English Name Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid
Molecular Formula C14H19NO5
Molecular Weight 281.31 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC=CC=C1O
InChIKey KWISQTDJMMIQCM-SNVBAGLBSA-N
Last Updated: 2026-03-06 12:52

Related Q&A

Compound Q&A

What regulatory guidelines apply to Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5)?

Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5) is subject to various regulat...

Compound Q&A

Are there alternatives to Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid in synthesis (CAS: 500788-88-5)?

Yes, there are alternatives to Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid in synthesis, suc...

Compound Q&A

How should waste containing Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5) be handled?

Waste containing Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5) should be ha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...