Compound Q&A

Are there alternatives to Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid in synthesis (CAS: 500788-88-5)?

Answer

Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid
Yes, there are alternatives to Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid in synthesis, such as other Boc-protected amino acids or protected derivatives. Commonly used reagents include Boc-(S)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid and other amino acid derivatives. These alternatives can offer similar functionalities and can be selected based on the specific needs of the synthesis.

About

English Name Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid
Molecular Formula C14H19NO5
Molecular Weight 281.31 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC=CC=C1O
InChIKey KWISQTDJMMIQCM-SNVBAGLBSA-N
Last Updated: 2026-03-06 12:52

Related Q&A

Compound Q&A

What regulatory guidelines apply to Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5)?

Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5) is subject to various regulat...

Compound Q&A

What is the market or research trend for Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5)?

The market and research trends for Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-...

Compound Q&A

How should waste containing Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5) be handled?

Waste containing Boc-(R)-3-Amino-3-(2-hydroxy-phenyl)-propionic acid (CAS: 500788-88-5) should be ha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...