Compound Q&A

What are the physical and chemical properties of Chlormadinone (CAS: 1961-77-9)?

Answer

Chlormadinone
Chlormadinone (CAS: 1961-77-9) is a white crystalline solid with a molecular weight of approximately 296.8 g/mol. It has a melting point of about 75-77°C and is slightly soluble in water. Chlormadinone is stable under normal conditions but can be reactive with strong bases. It is used as an intermediate in the synthesis of progestins and has limited solubility in organic solvents like ethanol and acetone.

About

CAS No 1961-77-9
English Name Chlormadinone
Molecular Formula C21H27ClO3
Molecular Weight 362.9 g/mol
SMILES CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)CCC34C)Cl)C)O
InChIKey VUHJZBBCZGVNDZ-TTYLFXKOSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

How is Chlormadinone (CAS: 1961-77-9) typically synthesized?

Chlormadinone (CAS: 1961-77-9) is typically synthesized through a multi-step process involving the r...

Compound Q&A

What industries use Chlormadinone (CAS: 1961-77-9)?

Chlormadinone (CAS: 1961-77-9) is primarily used in the pharmaceutical industry as an intermediate i...

Compound Q&A

What precautions should be taken when handling Chlormadinone (CAS: 1961-77-9)?

When handling Chlormadinone (CAS: 1961-77-9), appropriate personal protective equipment (PPE) such a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...