Compound Q&A

What industries use 4-(imidazol-1-ylmethyl)benzonitrile (CAS: 112809-54-8)?

Answer

4-(imidazol-1-ylmethyl)benzonitrile
4-(imidazol-1-ylmethyl)benzonitrile is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of certain drugs. It is also used in the development of sensors and semiconductors due to its functional groups that can participate in various chemical reactions. In polymers, it can act as a stabilizer or a reactive monomer. Its use in these industries highlights its versatility in chemical applications.

About

English Name 4-(imidazol-1-ylmethyl)benzonitrile
Molecular Formula C11H9N3
Molecular Weight 17.03 g/mol
SMILES C1=CC(=CC=C1CN2C=CN=C2)C#N
InChIKey LUSFCTSUDCCYLQ-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(imidazol-1-ylmethyl)benzonitrile (CAS: 112809-54-8)?

4-(imidazol-1-ylmethyl)benzonitrile is a white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 4-(imidazol-1-ylmethyl)benzonitrile (CAS: 112809-54-8) typically synthesized?

4-(imidazol-1-ylmethyl)benzonitrile is typically synthesized by the reaction of 4-bromoaniline with ...

Compound Q&A

What precautions should be taken when handling 4-(imidazol-1-ylmethyl)benzonitrile (CAS: 112809-54-8)?

When handling 4-(imidazol-1-ylmethyl)benzonitrile, it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...