Compound Q&A

What precautions should be taken when handling 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7)?

Answer

4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid
When handling 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid, appropriate personal protective equipment (PPE) should be worn, including gloves, safety goggles, and a lab coat. It should be stored in a cool, dry place away from direct sunlight and other potential fire hazards. In case of a spill, it should be cleaned up using appropriate absorbent materials and discarded in a proper waste disposal system. Always refer to the material safety data sheet (MSDS) for detailed information and safety guidelines.

About

English Name 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid
Molecular Formula C13H14O5
Molecular Weight 250.2473 g/mol
SMILES CC(=O)Oc1ccc(cc1OCC1CC1)C(=O)O
InChIKey FDEYOJNKVOZUEW-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7)?

4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid is a white to off-white crystalline solid with a molecu...

Compound Q&A

How is 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7) typically synthesized?

This compound can be synthesized via esterification of 3-(cyclopropylmethoxy)benzoic acid with aceti...

Compound Q&A

What industries use 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7)?

4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid is primarily used in the pharmaceutical industry for it...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...