Compound Q&A

What industries use 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7)?

Answer

4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid
4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid is primarily used in the pharmaceutical industry for its intermediate role in the synthesis of various bioactive compounds. It may also find applications in the chemical industry for the development of new materials and in analytical chemistry as a reagent or standard for spectroscopic analysis.

About

English Name 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid
Molecular Formula C13H14O5
Molecular Weight 250.2473 g/mol
SMILES CC(=O)Oc1ccc(cc1OCC1CC1)C(=O)O
InChIKey FDEYOJNKVOZUEW-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7)?

4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid is a white to off-white crystalline solid with a molecu...

Compound Q&A

How is 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7) typically synthesized?

This compound can be synthesized via esterification of 3-(cyclopropylmethoxy)benzoic acid with aceti...

Compound Q&A

What precautions should be taken when handling 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid (CAS: 1883347-32-7)?

When handling 4-Acetoxy-3-(cyclopropylmethoxy)benzoic acid, appropriate personal protective equipmen...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...