Compound Q&A

What industries use 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4)?

Answer

3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde
3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde is used in the pharmaceutical industry for the synthesis of certain organic compounds and in the polymer industry as a precursor for functionalized polymers. It is also utilized in the development of sensors and semiconductors due to its specific chemical properties.

About

CAS No 99815-16-4
English Name 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde
Molecular Formula C19H34O3Si2
Molecular Weight 366.65 g/mol
SMILES CC(C)(C)[Si](C)(C)OC1=C(C=C(C=C1)C=O)O[Si](C)(C)C(C)(C)C
InChIKey OTENVZJLWMQSAT-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4)?

3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde is a crystalline solid with a molecular...

Compound Q&A

How is 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4) typically synthesized?

3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde is typically synthesized through a sily...

Compound Q&A

What precautions should be taken when handling 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4)?

Proper safety precautions must be taken when handling 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]ox...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...