Compound Q&A

How is 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4) typically synthesized?

Answer

3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde
3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde is typically synthesized through a silylation reaction of benzaldehyde with dimethyl(2-methyl-2-propanyl)silanol in the presence of a catalytic amount of an acid such as hydrochloric acid. The reaction is carried out under anhydrous conditions to maximize yield and selectivity. The product is isolated by recrystallization or distillation.

About

CAS No 99815-16-4
English Name 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde
Molecular Formula C19H34O3Si2
Molecular Weight 366.65 g/mol
SMILES CC(C)(C)[Si](C)(C)OC1=C(C=C(C=C1)C=O)O[Si](C)(C)C(C)(C)C
InChIKey OTENVZJLWMQSAT-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4)?

3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde is a crystalline solid with a molecular...

Compound Q&A

What industries use 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4)?

3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde is used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]oxy}benzaldehyde (CAS: 99815-16-4)?

Proper safety precautions must be taken when handling 3,4-Bis{[dimethyl(2-methyl-2-propanyl)silyl]ox...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...