Compound Q&A

What industries use 3-Oxo-4-isoindolinecarbaldehyde (CAS: 771-08-4)?

Answer

3-Oxo-4-isoindolinecarbaldehyde
3-Oxo-4-isoindolinecarbaldehyde (CAS: 771-08-4) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those involving isoindoline scaffolds. It is also used in the polymer industry as a monomer for the production of certain types of polymers. Additionally, it finds applications in the production of sensors and semiconductors due to its reactive nature and ability to participate in various chemical reactions.

About

CAS No 771-08-4
English Name 3-Oxo-4-isoindolinecarbaldehyde
Molecular Formula C9H7NO2
Molecular Weight 161.16 g/mol
SMILES C1C2=C(C(=CC=C2)C=O)C(=O)N1
InChIKey IUZIMWDWXWFSKZ-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Oxo-4-isoindolinecarbaldehyde (CAS: 771-08-4)?

3-Oxo-4-isoindolinecarbaldehyde (CAS: 771-08-4) is a white crystalline solid with a molecular weight...

Compound Q&A

How is 3-Oxo-4-isoindolinecarbaldehyde (CAS: 771-08-4) typically synthesized?

3-Oxo-4-isoindolinecarbaldehyde is typically synthesized through the condensation of 4-isoindoline-1...

Compound Q&A

What precautions should be taken when handling 3-Oxo-4-isoindolinecarbaldehyde (CAS: 771-08-4)?

When handling 3-Oxo-4-isoindolinecarbaldehyde (CAS: 771-08-4), it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...