Compound Q&A

What industries use (1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester (CAS: 198835-07-3)?

Answer

2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester, (1R,4R,5R)-rel-
(1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester is primarily used in the pharmaceutical industry for the synthesis of complex organic compounds. It also finds applications in polymer production, where it can serve as a functional monomer. Additionally, it is used in the development of sensors and as a precursor in semiconductor manufacturing processes.

About

English Name 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester, (1R,4R,5R)-rel-
Molecular Formula C11H19NO3
Molecular Weight 213.27 g/mol
SMILES O[C@@H]1C[C@H]2C[C@@H]1CN2C(=O)OC(C)(C)C
InChIKey HDPGSWMTDGGUEB-IWSPIJDZSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester (CAS: 198835-07-3)?

(1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester is a wh...

Compound Q&A

How is (1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester (CAS: 198835-07-3) typically synthesized?

(1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester can be ...

Compound Q&A

What precautions should be taken when handling (1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl ester (CAS: 198835-07-3)?

When handling (1R,4R,5R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-hydroxy-, 1,1-dimethylethyl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...