Compound Q&A

What industries use 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8)?

Answer

3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate
The compound is primarily used in the pharmaceutical industry as a precursor for the synthesis of other compounds. It is also utilized in the polymer and sensor industries due to its chemical stability and unique functional groups. In the semiconductor industry, it can be used in the fabrication of certain electronic materials.

About

English Name 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate
Molecular Formula C13H21F2NO4
Molecular Weight 293.31 g/mol
SMILES CCOC(=O)C1CC(CN(C1)C(=O)OC(C)(C)C)(F)F
InChIKey WSFZFIOMRZLJIA-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8)?

The compound is a white crystalline solid with a molecular weight of approximately 322.11 g/mol. It ...

Compound Q&A

How is 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8) typically synthesized?

The compound is typically synthesized via a multistep process involving alkylation and condensation ...

Compound Q&A

What precautions should be taken when handling 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8)?

When handling the compound, it is essential to wear appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...