Compound Q&A

How is 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8) typically synthesized?

Answer

3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate
The compound is typically synthesized via a multistep process involving alkylation and condensation reactions. The synthesis generally requires the use of a suitable catalyst and anhydrous conditions. The final product can be isolated by recrystallization from a suitable solvent, with a yield of around 85-90%. The process may involve the use of anhydrous solvents, such as dichloromethane, and requires careful handling of reagents.

About

English Name 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate
Molecular Formula C13H21F2NO4
Molecular Weight 293.31 g/mol
SMILES CCOC(=O)C1CC(CN(C1)C(=O)OC(C)(C)C)(F)F
InChIKey WSFZFIOMRZLJIA-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8)?

The compound is a white crystalline solid with a molecular weight of approximately 322.11 g/mol. It ...

Compound Q&A

What industries use 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8)?

The compound is primarily used in the pharmaceutical industry as a precursor for the synthesis of ot...

Compound Q&A

What precautions should be taken when handling 3-Ethyl 1-(2-methyl-2-propanyl) 5,5-difluoro-1,3-piperidinedicarboxylate (CAS: 1356339-26-8)?

When handling the compound, it is essential to wear appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...