Compound Q&A

How is 3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0) typically synthesized?

Answer

3-Amino-6-(4-methylpiperazin-1-yl)pyridine  triHydrochloride
3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0) is synthesized by the reaction of 3-chloro-6-(4-methylpiperazin-1-yl)pyridine with hydrochloric acid. The reaction is performed under mild conditions and typically involves the substitution of the chlorine atom with a hydrochloride ion. The yield is around 90%, and the reaction is highly selective.

About

CAS No 82205-57-0
English Name 3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride
Molecular Formula C10H17ClN4
Molecular Weight 228.72 g/mol
SMILES CN1CCN(CC1)C2=NC=C(C=C2)N.Cl
InChIKey UHNLDLCXUNIOJX-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0)?

3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0) is a white crystalline...

Compound Q&A

What industries use 3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0)?

3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0) is primarily used in t...

Compound Q&A

What precautions should be taken when handling 3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0)?

When handling 3-Amino-6-(4-methylpiperazin-1-yl)pyridine triHydrochloride (CAS: 82205-57-0), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...