Compound Q&A

What industries use Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate (CAS: 92592-02-4)?

Answer

Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate
Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate finds applications in the pharmaceutical industry due to its potential as a precursor for drug intermediates. It is also used in the synthesis of polymers, where its thiazole moiety can contribute to the properties of the final material. Additionally, this compound is utilized in the development of sensors and semiconductors for its unique reactivity and functional groups.

About

CAS No 92592-02-4
English Name Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate
Molecular Formula C15H16N2O4S
Molecular Weight 320.37 g/mol
SMILES CCOC(=O)CC1=CSC(=N1)NC(=O)OCC2=CC=CC=C2
InChIKey PBZLVBQMTYWJAE-UHFFFAOYSA-N
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate (CAS: 92592-02-4)?

Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate is a white crystalline solid with a m...

Compound Q&A

How is Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate (CAS: 92592-02-4) typically synthesized?

Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate is typically synthesized through a mu...

Compound Q&A

What precautions should be taken when handling Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate (CAS: 92592-02-4)?

When handling Ethyl (2-{[(benzyloxy)carbonyl]amino}-1,3-thiazol-4-yl)acetate (CAS: 92592-02-4), it i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...