Compound Q&A

How is Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7) typically synthesized?

Answer

Zinc bis(diethylcarbamodithioate)
Zinc bis(diethylcarbamodithioate) is typically synthesized by reacting zinc acetate with diethyl carbamodithioate. The reaction is usually carried out in the presence of a solvent like ethanol, and the product is isolated by filtration and recrystallization. The yield is generally around 85-90%, and the process can be optimized using appropriate catalysts and reaction conditions.

About

CAS No 136-94-7
English Name Zinc bis(diethylcarbamodithioate)
Molecular Formula C10H20N2S4Zn
Molecular Weight 361.94 g/mol
SMILES CCN(CC)C(=S)S[Zn]SC(=S)N(CC)CC
InChIKey RKQOSDAEEGPRER-UHFFFAOYSA-L
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

What are the physical and chemical properties of Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7)?

Zinc bis(diethylcarbamodithioate) is a crystalline solid with a molecular weight of approximately 28...

Compound Q&A

What industries use Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7)?

Zinc bis(diethylcarbamodithioate) finds applications in various industries. It is used in the pharma...

Compound Q&A

What precautions should be taken when handling Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7)?

When handling Zinc bis(diethylcarbamodithioate), it is essential to use appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...