Compound Q&A

What are the physical and chemical properties of Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7)?

Answer

Zinc bis(diethylcarbamodithioate)
Zinc bis(diethylcarbamodithioate) is a crystalline solid with a molecular weight of approximately 288.45 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and diethyl ether. This compound is relatively stable but can react with moisture to form zinc carbonate. It shows good reactivity towards thiols and other nucleophiles.

About

CAS No 136-94-7
English Name Zinc bis(diethylcarbamodithioate)
Molecular Formula C10H20N2S4Zn
Molecular Weight 361.94 g/mol
SMILES CCN(CC)C(=S)S[Zn]SC(=S)N(CC)CC
InChIKey RKQOSDAEEGPRER-UHFFFAOYSA-L
Last Updated: 2026-03-05 06:57

Related Q&A

Compound Q&A

How is Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7) typically synthesized?

Zinc bis(diethylcarbamodithioate) is typically synthesized by reacting zinc acetate with diethyl car...

Compound Q&A

What industries use Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7)?

Zinc bis(diethylcarbamodithioate) finds applications in various industries. It is used in the pharma...

Compound Q&A

What precautions should be taken when handling Zinc bis(diethylcarbamodithioate) (CAS: 136-94-7)?

When handling Zinc bis(diethylcarbamodithioate), it is essential to use appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...