Compound Q&A

What industries use 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

Answer

4-(Acetoxymethyl)-3-bromobenzoic acid
4-(Acetoxymethyl)-3-bromobenzoic acid is primarily used in the pharmaceutical industry for the synthesis of various drugs and intermediates. It is also used in the polymer industry for modifying polymer properties and in the sensor industry for developing sensitive detection systems. Its reactivity towards nucleophiles makes it valuable in semiconductor applications as well.

About

CAS No 90772-73-9
English Name 4-(Acetoxymethyl)-3-bromobenzoic acid
Molecular Formula C10H9BrO4
Molecular Weight 273.082 g/mol
SMILES CC(=O)OCC1=C(C=C(C=C1)C(=O)O)Br
InChIKey GGEQCBQMZSMHCO-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

4-(Acetoxymethyl)-3-bromobenzoic acid is a white or off-white crystalline solid with a molecular wei...

Compound Q&A

How is 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9) typically synthesized?

4-(Acetoxymethyl)-3-bromobenzoic acid can be synthesized through a multi-step reaction starting from...

Compound Q&A

What precautions should be taken when handling 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

When handling 4-(Acetoxymethyl)-3-bromobenzoic acid, it is essential to wear appropriate personal pr...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...