Compound Q&A

How is 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9) typically synthesized?

Answer

4-(Acetoxymethyl)-3-bromobenzoic acid
4-(Acetoxymethyl)-3-bromobenzoic acid can be synthesized through a multi-step reaction starting from 3-bromobenzoic acid. The key steps include esterification of the carboxylic acid group to form the acetate ester, followed by bromination of the hydroxyl group at the methyl position. This process typically involves the use of acetic anhydride and a suitable base as a catalyst.

About

CAS No 90772-73-9
English Name 4-(Acetoxymethyl)-3-bromobenzoic acid
Molecular Formula C10H9BrO4
Molecular Weight 273.082 g/mol
SMILES CC(=O)OCC1=C(C=C(C=C1)C(=O)O)Br
InChIKey GGEQCBQMZSMHCO-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

4-(Acetoxymethyl)-3-bromobenzoic acid is a white or off-white crystalline solid with a molecular wei...

Compound Q&A

What industries use 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

4-(Acetoxymethyl)-3-bromobenzoic acid is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

When handling 4-(Acetoxymethyl)-3-bromobenzoic acid, it is essential to wear appropriate personal pr...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...