Compound Q&A

What are the physical and chemical properties of 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

Answer

4-(Acetoxymethyl)-3-bromobenzoic acid
4-(Acetoxymethyl)-3-bromobenzoic acid is a white or off-white crystalline solid with a molecular weight of approximately 286.04 g/mol. It is poorly soluble in water but soluble in most organic solvents. This compound exhibits moderate reactivity, particularly towards nucleophiles and bases, and is often used in organic synthesis due to its functional groups.

About

CAS No 90772-73-9
English Name 4-(Acetoxymethyl)-3-bromobenzoic acid
Molecular Formula C10H9BrO4
Molecular Weight 273.082 g/mol
SMILES CC(=O)OCC1=C(C=C(C=C1)C(=O)O)Br
InChIKey GGEQCBQMZSMHCO-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9) typically synthesized?

4-(Acetoxymethyl)-3-bromobenzoic acid can be synthesized through a multi-step reaction starting from...

Compound Q&A

What industries use 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

4-(Acetoxymethyl)-3-bromobenzoic acid is primarily used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 4-(Acetoxymethyl)-3-bromobenzoic acid (CAS: 90772-73-9)?

When handling 4-(Acetoxymethyl)-3-bromobenzoic acid, it is essential to wear appropriate personal pr...

155412-88-71-(3-Aminophenyl)-3-...
Compound Q&A

How should waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 19132-12-8) be handled?

Waste containing 1-(D-Ribofuranosyl)-1,4-dihydro-3-pyridinecarboxamide (CAS: 191...

19132-12-81-(D-Ribofuranosyl)-...
Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 2007919-81-3)?

2-Methyl-2-propanyl 3-bromo-3-(hydroxymethyl)-1-azetidinecarboxylate (CAS: 20079...

2007919-81-32-Methyl-2-propanyl ...
Compound Q&A

What is N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0)?

N-(4-Chloro-2-pyridinyl)acetamide (CAS: 245056-66-0) is a chemical compound with...

245056-66-0N-(4-Chloro-2-pyridi...