Compound Q&A

What precautions should be taken when handling 4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione (CAS: 1352827-50-9)?

Answer

4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione
When handling 4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area, such as a fume hood, due to its potential to release toxic vapors. In case of a spill, immediately clean it up with appropriate absorbent materials and consult the Safety Data Sheet (SDS) for further instructions.

About

English Name 4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione
Molecular Formula C14H13N3O4
Molecular Weight 287.28 g/mol
SMILES CN1C(=O)CCC(N2C(=O)c3cccc(N)c3C2=O)C1=O
InChIKey YSWQOCGODHPKED-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione (CAS: 1352827-50-9)?

4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione is a crystalline solid with ...

Compound Q&A

How is 4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione (CAS: 1352827-50-9) typically synthesized?

4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione is synthesized via a multi-s...

Compound Q&A

What industries use 4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione (CAS: 1352827-50-9)?

4-Amino-2-(1-methyl-2,6-dioxo-3-piperidinyl)-1H-isoindole-1,3(2H)-dione is primarily used in the pha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...