Compound Q&A

What are the physical and chemical properties of 2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine (CAS: 86163-17-9)?

Answer

2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine
2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine is a nucleoside derivative with a molecular weight of approximately 313.22 g/mol. It exists in a crystalline form and has a high solubility in polar solvents like methanol and water but is insoluble in non-polar solvents. This compound shows moderate reactivity towards nucleophilic substitution at the uracil position.

About

CAS No 86163-17-9
English Name 2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine
Molecular Formula C13H16N2O7
Molecular Weight 312.28 g/mol
SMILES COC(=O)/C=C/c1cn(c(=O)[nH]c1=O)[C@H]2C[C@@H]([C@H](O2)CO)O
InChIKey RKTRMSPWWLPPAY-YJCWOPNRSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine (CAS: 86163-17-9) typically synthesized?

2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine is typically synthesized via a multistep rout...

Compound Q&A

What industries use 2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine (CAS: 86163-17-9)?

2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine finds applications in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine (CAS: 86163-17-9)?

When handling 2'-Deoxy-5-[(1E)-3-methoxy-3-oxo-1-propen-1-yl]uridine, it is crucial to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...