Compound Q&A

What industries use 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4)?

Answer

1-isopropylcyclohexyl Methacrylate
1-Isopropylcyclohexyl methacrylate (CAS: 811440-77-4) is primarily used in the polymer industry for the synthesis of advanced polymers. It is also explored for its applications in pharmaceuticals, as a monomer for developing sensors, and in the manufacturing of materials for semiconductors.

About

English Name 1-isopropylcyclohexyl Methacrylate
Molecular Formula C13H22O2
Molecular Weight 210.31 g/mol
SMILES CC(C)C1(CCCCC1)OC(=O)C(=C)C
InChIKey KDSLFWBFCGYUIQ-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4)?

1-Isopropylcyclohexyl methacrylate (CAS: 811440-77-4) is a colorless to light yellow liquid with a m...

Compound Q&A

How is 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4) typically synthesized?

1-Isopropylcyclohexyl methacrylate (CAS: 811440-77-4) is synthesized by reacting 1-isopropylcyclohex...

Compound Q&A

What precautions should be taken when handling 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4)?

When handling 1-isopropylcyclohexyl methacrylate (CAS: 811440-77-4), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...