Compound Q&A

What are the physical and chemical properties of 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4)?

Answer

1-isopropylcyclohexyl Methacrylate
1-Isopropylcyclohexyl methacrylate (CAS: 811440-77-4) is a colorless to light yellow liquid with a molecular weight of approximately 228.36 g/mol. It has a high solubility in common organic solvents such as toluene and ethyl acetate. Chemically, it is reactive, particularly towards nucleophiles and radical species, making it useful in polymerization reactions.

About

English Name 1-isopropylcyclohexyl Methacrylate
Molecular Formula C13H22O2
Molecular Weight 210.31 g/mol
SMILES CC(C)C1(CCCCC1)OC(=O)C(=C)C
InChIKey KDSLFWBFCGYUIQ-UHFFFAOYSA-N
Last Updated: 2026-03-05 02:11

Related Q&A

Compound Q&A

How is 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4) typically synthesized?

1-Isopropylcyclohexyl methacrylate (CAS: 811440-77-4) is synthesized by reacting 1-isopropylcyclohex...

Compound Q&A

What industries use 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4)?

1-Isopropylcyclohexyl methacrylate (CAS: 811440-77-4) is primarily used in the polymer industry for ...

Compound Q&A

What precautions should be taken when handling 1-isopropylcyclohexyl Methacrylate (CAS: 811440-77-4)?

When handling 1-isopropylcyclohexyl methacrylate (CAS: 811440-77-4), it is essential to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...