Compound Q&A

What industries use 5-[4-(Methylsulfonyl)phenyl]-6'-(trifluoromethyl)-3,3'-bipyridin-2-amine (CAS: 1314883-11-8)?

Answer

5-[4-(Methylsulfonyl)phenyl]-6'-(trifluoromethyl)-3,3'-bipyridin-2-amine
The compound is primarily used in the pharmaceutical industry for its potential as a drug candidate due to its specific chemical structure. It also has applications in the development of sensors and as a precursor in the semiconductor industry for its electronic properties.

About

English Name 5-[4-(Methylsulfonyl)phenyl]-6'-(trifluoromethyl)-3,3'-bipyridin-2-amine
Molecular Formula C18H14F3N3O2S
Molecular Weight 393.39 g/mol
SMILES CS(=O)(=O)c1ccc(cc1)c2cc(c(nc2)N)c3ccc(nc3)C(F)(F)F
InChIKey RTJQABCNNLMCJF-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[4-(Methylsulfonyl)phenyl]-6'-(trifluoromethyl)-3,3'-bipyridin-2-amine (CAS: 1314883-11-8)?

The compound is a crystalline solid with a molecular weight of approximately 474.4 g/mol. It has low...

Compound Q&A

How is 5-[4-(Methylsulfonyl)phenyl]-6'-(trifluoromethyl)-3,3'-bipyridin-2-amine (CAS: 1314883-11-8) typically synthesized?

The compound is synthesized via a multi-step process involving the reaction of 4-(methylsulfonyl)ben...

Compound Q&A

What precautions should be taken when handling 5-[4-(Methylsulfonyl)phenyl]-6'-(trifluoromethyl)-3,3'-bipyridin-2-amine (CAS: 1314883-11-8)?

Proper Personal Protective Equipment (PPE) is essential, including gloves, goggles, and a lab coat. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...