Compound Q&A

What are the physical and chemical properties of Bimatoprost acid methyl ester (CAS: 38315-47-8)?

Answer

Bimatoprost acid methyl ester
Bimatoprost acid methyl ester (CAS: 38315-47-8) is a white to off-white crystalline solid with a molecular weight of approximately 314.34 g/mol. It has a melting point of 82-84°C. It is slightly soluble in water but more soluble in organic solvents such as methanol and ethanol. The compound is relatively stable under normal storage conditions but should be protected from light and heat to maintain its integrity.

About

CAS No 38315-47-8
English Name Bimatoprost acid methyl ester
Molecular Formula C24H34O5
Molecular Weight 402.53 g/mol
SMILES COC(=O)CCCC=CCC1C(CC(C1C=CC(CCC2=CC=CC=C2)O)O)O
InChIKey UQBYFURYGYNQLQ-FDBOBMRISA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

How is Bimatoprost acid methyl ester (CAS: 38315-47-8) typically synthesized?

Bimatoprost acid methyl ester (CAS: 38315-47-8) is typically synthesized by the methylation of bimat...

Compound Q&A

What industries use Bimatoprost acid methyl ester (CAS: 38315-47-8)?

Bimatoprost acid methyl ester (CAS: 38315-47-8) is primarily used in the pharmaceutical industry, pa...

Compound Q&A

What precautions should be taken when handling Bimatoprost acid methyl ester (CAS: 38315-47-8)?

When handling Bimatoprost acid methyl ester (CAS: 38315-47-8), it is important to use appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...