Compound Q&A

What precautions should be taken when handling 5-Chloro-6-isoquinolinol (CAS: 918488-41-2)?

Answer

5-Chloro-6-isoquinolinol
When handling 5-Chloro-6-isoquinolinol (CAS: 918488-41-2), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be carried out in a well-ventilated fume hood to minimize exposure. In case of a spill, neutralize any strong acids or bases present before cleaning up. Always consult the Material Safety Data Sheet (MSDS) for detailed safety guidelines and emergency procedures.

About

English Name 5-Chloro-6-isoquinolinol
Molecular Formula C9H6ClNO
Molecular Weight 179.61 g/mol
SMILES C1=CC(=C(C2=C1C=NC=C2)Cl)O
InChIKey ALTPGTZNQQAMJI-UHFFFAOYSA-N
Last Updated: 2026-03-04 21:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-6-isoquinolinol (CAS: 918488-41-2)?

5-Chloro-6-isoquinolinol (CAS: 918488-41-2) is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 5-Chloro-6-isoquinolinol (CAS: 918488-41-2) typically synthesized?

5-Chloro-6-isoquinolinol (CAS: 918488-41-2) is commonly synthesized via the chlorination of 6-isoqui...

Compound Q&A

What industries use 5-Chloro-6-isoquinolinol (CAS: 918488-41-2)?

5-Chloro-6-isoquinolinol (CAS: 918488-41-2) is primarily used in the pharmaceutical industry as an i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...