Compound Q&A

How is 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0) typically synthesized?

Answer

3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide
The compound is usually synthesized via a multistep process involving diazotization, coupling reactions, and diazotiation. Commonly used catalysts include Lewis acids, and the reaction conditions typically require a temperature range of 0-50°C. The overall yield is around 60-70%, with high selectivity towards the desired product.

About

CAS No 6448-96-0
English Name 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide
Molecular Formula C31H23N5O6
Molecular Weight 561.5 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)NC2=CC=CC=C2)N=NC3=C(C(=CC4=CC=CC=C43)C(=O)NC5=CC(=CC=C5)[N+](=O)[O-])O
InChIKey GLZGTQYOWXFUNZ-XAHDOWKMSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0)?

The compound is a crystalline solid with a molecular weight of approximately 714.86 g/mol. It has li...

Compound Q&A

What industries use 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a medicinal inte...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...