Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0)?

Answer

3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide
The compound is a crystalline solid with a molecular weight of approximately 714.86 g/mol. It has limited solubility in water but is more soluble in organic solvents like ethanol. The compound is stable under normal conditions but can react with strong bases to form the corresponding anion. It also shows reactivity towards nucleophiles due to the presence of the diazenyl and nitro groups.

About

CAS No 6448-96-0
English Name 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide
Molecular Formula C31H23N5O6
Molecular Weight 561.5 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)NC2=CC=CC=C2)N=NC3=C(C(=CC4=CC=CC=C43)C(=O)NC5=CC(=CC=C5)[N+](=O)[O-])O
InChIKey GLZGTQYOWXFUNZ-XAHDOWKMSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

How is 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0) typically synthesized?

The compound is usually synthesized via a multistep process involving diazotization, coupling reacti...

Compound Q&A

What industries use 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0)?

This compound is primarily used in the pharmaceutical industry for its potential as a medicinal inte...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-4-{(E)-[2-methoxy-5-(phenylcarbamoyl)phenyl]diazenyl}-N-(3-nitrophenyl)-2-naphthamide (CAS: 6448-96-0)?

Handling this compound requires the use of personal protective equipment (PPE) such as gloves, goggl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...