Compound Q&A

How is 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2) typically synthesized?

Answer

3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline
3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline is typically synthesized via the reaction of 6-methoxyquinoxaline with 3,3-difluoro-2-buten-1-yl chloride in the presence of a suitable base, such as triethylamine. This process provides good yield and selectivity, though optimal conditions may vary based on the specific reagents and solvents used.

About

English Name 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline
Molecular Formula C13H11ClF2N2O
Molecular Weight 284.69 g/mol
SMILES COc1ccc2c(c1)nc(c(n2)C(CC=C)(F)F)Cl
InChIKey BPSVWHVEZIDAHQ-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2)?

3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline is a crystalline solid with a molecular ...

Compound Q&A

What industries use 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2)?

3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2)?

When handling 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline, proper personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...