Compound Q&A

What are the physical and chemical properties of 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2)?

Answer

3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline
3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline is a crystalline solid with a molecular weight of approximately 339.74 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and ethanol. The compound exhibits moderate reactivity, particularly towards nucleophiles and electrophiles. It is stable under normal conditions but should be handled with care to avoid decomposition or reaction with other chemicals.

About

English Name 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline
Molecular Formula C13H11ClF2N2O
Molecular Weight 284.69 g/mol
SMILES COc1ccc2c(c1)nc(c(n2)C(CC=C)(F)F)Cl
InChIKey BPSVWHVEZIDAHQ-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

How is 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2) typically synthesized?

3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline is typically synthesized via the reactio...

Compound Q&A

What industries use 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2)?

3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline (CAS: 1799733-46-2)?

When handling 3-Chloro-2-(1,1-difluoro-3-buten-1-yl)-6-methoxyquinoxaline, proper personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...