Compound Q&A

Is (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) safe?

Answer

(4-Phenylcyclohexyl)acetic acid
(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) is generally considered safe when handled with appropriate precautions. However, it should be stored away from direct sunlight and handled with gloves to prevent skin contact. Always follow safety guidelines and use in a well-ventilated area.

About

CAS No 52092-29-2
English Name (4-Phenylcyclohexyl)acetic acid
Molecular Formula C14H18O2
Molecular Weight 218.3 g/mol
SMILES c1ccc(cc1)C2CCC(CC2)CC(=O)O
InChIKey PBYZBGVGPMEGRS-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What is (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2)?

(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) is a chemical compound with a unique structure com...

Compound Q&A

What are the main uses of (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2)?

(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) is primarily used in the pharmaceutical industry a...

Compound Q&A

How should (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) be stored?

(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) should be stored in a cool, dry place away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...