Compound Q&A

What are the main uses of (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2)?

Answer

(4-Phenylcyclohexyl)acetic acid
(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) is primarily used in the pharmaceutical industry as a precursor for drug synthesis and in research settings for its structural properties. It can also be used in some cosmetic and chemical applications.

About

CAS No 52092-29-2
English Name (4-Phenylcyclohexyl)acetic acid
Molecular Formula C14H18O2
Molecular Weight 218.3 g/mol
SMILES c1ccc(cc1)C2CCC(CC2)CC(=O)O
InChIKey PBYZBGVGPMEGRS-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What is (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2)?

(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) is a chemical compound with a unique structure com...

Compound Q&A

Is (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) safe?

(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) is generally considered safe when handled with app...

Compound Q&A

How should (4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) be stored?

(4-Phenylcyclohexyl)acetic acid (CAS: 52092-29-2) should be stored in a cool, dry place away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...