Compound Q&A

What is Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4)?

Answer

Amyloid beta-Protein (Human, 1-43)
Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4) is a synthetic peptide corresponding to the first 43 amino acids of the amyloid beta protein derived from the human brain. It is used in research to model neurodegenerative diseases such as Alzheimer's disease.

About

English Name Amyloid beta-Protein (Human, 1-43)
Molecular Formula C86H150N22O27S
Molecular Weight 1956.31 g/mol
SMILES NCCCCC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)C(O)C)C)C(CC)C)C(C)C)C(C)C)C(C)C)CCSC)CC(C)C)C(CC)C)C(CC)C)C)NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(C(C)C)NC(=O)CCC(=O)O)CO)CC(=O)N
InChIKey LBJNSYPWMXQDNQ-UHFFFAOYSA-N
Last Updated: 2026-03-04 03:05

Related Q&A

Compound Q&A

What are the main uses of Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4)?

Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4) is primarily used in pharmaceutical and biomed...

Compound Q&A

Is Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4) safe?

Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4) is generally considered safe when handled acco...

Compound Q&A

How should Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4) be stored?

Amyloid beta-Protein (Human, 1-43) (CAS: 134500-80-4) should be stored in a tightly sealed vial at -...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...